C21H31N5O2 — CID 163117779
3-[(2S,5aS,8aS)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 163117779) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[(2S,5aS,8aS)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[(2S,5aS,8aS)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 163117779 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 3-[(2S,5aS,8aS)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | CN1[C@@H](CCC(=O)NCc2cccnc2)CNC(=O)[C@@H]2[C@@H]1CCN2CC1CC1 |
| InChI | InChI=1S/C21H31N5O2/c1-25-17(6-7-19(27)23-12-16-3-2-9-22-11-16)13-24-21(28)20-18(25)8-10-26(20)14-15-4-5-15/h2-3,9,11,15,17-18,20H,4-8,10,12-14H2,1H3,(H,23,27)(H,24,28)/t17-,18-,20-/m0/s1 |
| InChIKey | ALCASKFEYQNXPX-BJLQDIEVSA-N |
| XLogP | 0.76 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |