C15H21ClN2O4S — CID 45373876
2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-prop-2-enylacetamide (PubChem CID 45373876) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-prop-2-enylacetamide.
| Compound Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 45373876 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN(CC)S(=O)(=O)c1ccc(OCC)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O4S/c1-4-9-17-15(19)11-18(5-2)23(20,21)12-7-8-14(22-6-3)13(16)10-12/h4,7-8,10H,1,5-6,9,11H2,2-3H3,(H,17,19) |
| InChIKey | GLYQYGXQUAZUBO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|