C21H28ClN3O6S2 — CID 100798036
2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100798036) has the molecular formula C21H28ClN3O6S2 and a molecular weight of 518.06 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100798036 |
| Molecular Formula | C21H28ClN3O6S2 |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC(=O)NCCNS(=O)(=O)c2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C21H28ClN3O6S2/c1-4-25(33(29,30)18-10-11-20(31-5-2)19(22)14-18)15-21(26)23-12-13-24-32(27,28)17-8-6-16(3)7-9-17/h6-11,14,24H,4-5,12-13,15H2,1-3H3,(H,23,26) |
| InChIKey | PGMGEHMXWKPWMR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|