C22H22ClN3O3S2 — CID 4537464
2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-cyclopentylacetamide (PubChem CID 4537464) has the molecular formula C22H22ClN3O3S2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-cyclopentylacetamide.
| Compound Name | 2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 4537464 |
| Molecular Formula | C22H22ClN3O3S2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyl-N-cyclopentylacetamide |
| SMILES | COc1ccc(N2C(=O)C(=Cc3cccs3)N=C2SCC(=O)NC2CCCC2)cc1Cl |
| InChI | InChI=1S/C22H22ClN3O3S2/c1-29-19-9-8-15(11-17(19)23)26-21(28)18(12-16-7-4-10-30-16)25-22(26)31-13-20(27)24-14-5-2-3-6-14/h4,7-12,14H,2-3,5-6,13H2,1H3,(H,24,27) |
| InChIKey | ZTAOVQOXNANGMB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|