C25H28ClN3O4S — CID 2413236
2-[(4Z)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-cyclooctylacetamide (PubChem CID 2413236) has the molecular formula C25H28ClN3O4S and a molecular weight of 502.04 g/mol. Its IUPAC name is 2-[(4Z)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-cyclooctylacetamide.
| Compound Name | 2-[(4Z)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-cyclooctylacetamide |
|---|---|
| PubChem CID | 2413236 |
| Molecular Formula | C25H28ClN3O4S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 2-[(4Z)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-cyclooctylacetamide |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3ccco3)N=C2SCC(=O)NC2CCCCCCC2)cc1Cl |
| InChI | InChI=1S/C25H28ClN3O4S/c1-32-22-12-11-18(14-20(22)26)29-24(31)21(15-19-10-7-13-33-19)28-25(29)34-16-23(30)27-17-8-5-3-2-4-6-9-17/h7,10-15,17H,2-6,8-9,16H2,1H3,(H,27,30)/b21-15- |
| InChIKey | PHYDSKDTWPWDCW-QNGOZBTKSA-N |
| XLogP | 5.65 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|