C18H14ClN3O3S — CID 7265035
3-[(4E)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanylpropanenitrile (PubChem CID 7265035) has the molecular formula C18H14ClN3O3S and a molecular weight of 387.85 g/mol. Its IUPAC name is 3-[(4E)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanylpropanenitrile.
| Compound Name | 3-[(4E)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 7265035 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 3-[(4E)-1-(3-chloro-4-methoxyphenyl)-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanylpropanenitrile |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3ccco3)N=C2SCCC#N)cc1Cl |
| InChI | InChI=1S/C18H14ClN3O3S/c1-24-16-6-5-12(10-14(16)19)22-17(23)15(11-13-4-2-8-25-13)21-18(22)26-9-3-7-20/h2,4-6,8,10-11H,3,9H2,1H3/b15-11+ |
| InChIKey | KMNBEFSZJKXOEI-RVDMUPIBSA-N |
| XLogP | 4.33 |
| TPSA | 78.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|