C24H21ClN2O4S — CID 4005933
3-(3-chloro-4-methoxyphenyl)-5-(furan-2-ylmethylidene)-2-[2-(4-methylphenoxy)ethylsulfanyl]imidazol-4-one (PubChem CID 4005933) has the molecular formula C24H21ClN2O4S and a molecular weight of 468.96 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-5-(furan-2-ylmethylidene)-2-[2-(4-methylphenoxy)ethylsulfanyl]imidazol-4-one.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-5-(furan-2-ylmethylidene)-2-[2-(4-methylphenoxy)ethylsulfanyl]imidazol-4-one |
|---|---|
| PubChem CID | 4005933 |
| Molecular Formula | C24H21ClN2O4S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-5-(furan-2-ylmethylidene)-2-[2-(4-methylphenoxy)ethylsulfanyl]imidazol-4-one |
| SMILES | COc1ccc(N2C(=O)C(=Cc3ccco3)N=C2SCCOc2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C24H21ClN2O4S/c1-16-5-8-18(9-6-16)31-12-13-32-24-26-21(15-19-4-3-11-30-19)23(28)27(24)17-7-10-22(29-2)20(25)14-17/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | CRMRVKPDFFJXPH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 64.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|