C26H22Cl2N2O2S — CID 4687901
5-[(2,3-dichlorophenyl)methylidene]-2-[2-(4-methylphenoxy)ethylsulfanyl]-3-(4-methylphenyl)imidazol-4-one (PubChem CID 4687901) has the molecular formula C26H22Cl2N2O2S and a molecular weight of 497.45 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)methylidene]-2-[2-(4-methylphenoxy)ethylsulfanyl]-3-(4-methylphenyl)imidazol-4-one.
| Compound Name | 5-[(2,3-dichlorophenyl)methylidene]-2-[2-(4-methylphenoxy)ethylsulfanyl]-3-(4-methylphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 4687901 |
| Molecular Formula | C26H22Cl2N2O2S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)methylidene]-2-[2-(4-methylphenoxy)ethylsulfanyl]-3-(4-methylphenyl)imidazol-4-one |
| SMILES | Cc1ccc(OCCSC2=NC(=Cc3cccc(Cl)c3Cl)C(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O2S/c1-17-6-10-20(11-7-17)30-25(31)23(16-19-4-3-5-22(27)24(19)28)29-26(30)33-15-14-32-21-12-8-18(2)9-13-21/h3-13,16H,14-15H2,1-2H3 |
| InChIKey | QHPVFSNHYHQJER-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|