C21H26N6O — CID 45380658
1-benzyl-3-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]urea (PubChem CID 45380658) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-benzyl-3-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]urea.
| Compound Name | 1-benzyl-3-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 45380658 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-benzyl-3-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]urea |
| SMILES | CN(C)CCNc1cc(-c2cn[nH]c2)ccc1NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H26N6O/c1-27(2)11-10-22-20-12-17(18-14-24-25-15-18)8-9-19(20)26-21(28)23-13-16-6-4-3-5-7-16/h3-9,12,14-15,22H,10-11,13H2,1-2H3,(H,24,25)(H2,23,26,28) |
| InChIKey | XKPSJWUCLGQXSN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |