C21H25N5O2 — CID 68562142
benzyl N-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]carbamate (PubChem CID 68562142) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is benzyl N-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]carbamate.
| Compound Name | benzyl N-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 68562142 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | benzyl N-[2-[2-(dimethylamino)ethylamino]-4-(1H-pyrazol-4-yl)phenyl]carbamate |
| SMILES | CN(C)CCNc1cc(-c2cn[nH]c2)ccc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25N5O2/c1-26(2)11-10-22-20-12-17(18-13-23-24-14-18)8-9-19(20)25-21(27)28-15-16-6-4-3-5-7-16/h3-9,12-14,22H,10-11,15H2,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | BCJBWDJSVMVQPH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |