C19H22F3N3O4S — CID 45381306
(3R)-2-methyl-3-[2-(4-prop-2-enylsulfonylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]oxybutan-2-ol (PubChem CID 45381306) has the molecular formula C19H22F3N3O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is (3R)-2-methyl-3-[2-(4-prop-2-enylsulfonylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]oxybutan-2-ol.
| Compound Name | (3R)-2-methyl-3-[2-(4-prop-2-enylsulfonylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]oxybutan-2-ol |
|---|---|
| PubChem CID | 45381306 |
| Molecular Formula | C19H22F3N3O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (3R)-2-methyl-3-[2-(4-prop-2-enylsulfonylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]oxybutan-2-ol |
| SMILES | C=CCS(=O)(=O)c1ccc(Nc2ncc(C(F)(F)F)c(O[C@H](C)C(C)(C)O)n2)cc1 |
| InChI | InChI=1S/C19H22F3N3O4S/c1-5-10-30(27,28)14-8-6-13(7-9-14)24-17-23-11-15(19(20,21)22)16(25-17)29-12(2)18(3,4)26/h5-9,11-12,26H,1,10H2,2-4H3,(H,23,24,25)/t12-/m1/s1 |
| InChIKey | JCPZVGATKUQPOE-GFCCVEGCSA-N |
| XLogP | 3.74 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|