C33H34F2N4O3S — CID 45381949
5-(2,4-difluorophenyl)-1-N-[(1R,2R)-1-hydroxy-3-phenyl-1-[(2S)-pyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide (PubChem CID 45381949) has the molecular formula C33H34F2N4O3S and a molecular weight of 604.72 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-1-N-[(1R,2R)-1-hydroxy-3-phenyl-1-[(2S)-pyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-(2,4-difluorophenyl)-1-N-[(1R,2R)-1-hydroxy-3-phenyl-1-[(2S)-pyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 45381949 |
| Molecular Formula | C33H34F2N4O3S |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 5-(2,4-difluorophenyl)-1-N-[(1R,2R)-1-hydroxy-3-phenyl-1-[(2S)-pyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1csc(CN(C)C(=O)c2cc(C(=O)N[C@H](Cc3ccccc3)[C@H](O)[C@@H]3CCCN3)cc(-c3ccc(F)cc3F)c2)n1 |
| InChI | InChI=1S/C33H34F2N4O3S/c1-20-19-43-30(37-20)18-39(2)33(42)24-15-22(26-11-10-25(34)17-27(26)35)14-23(16-24)32(41)38-29(13-21-7-4-3-5-8-21)31(40)28-9-6-12-36-28/h3-5,7-8,10-11,14-17,19,28-29,31,36,40H,6,9,12-13,18H2,1-2H3,(H,38,41)/t28-,29+,31+/m0/s1 |
| InChIKey | XNCJWTKTUUHPFV-ILJQZKEFSA-N |
| XLogP | 5.12 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |