C31H25N3O6 — CID 4541324
(3-methyl-4-phenylmethoxyphenyl)-[2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate (PubChem CID 4541324) has the molecular formula C31H25N3O6 and a molecular weight of 535.56 g/mol. Its IUPAC name is (3-methyl-4-phenylmethoxyphenyl)-[2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate.
| Compound Name | (3-methyl-4-phenylmethoxyphenyl)-[2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 4541324 |
| Molecular Formula | C31H25N3O6 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | (3-methyl-4-phenylmethoxyphenyl)-[2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate |
| SMILES | Cc1cc(C([O-])=C2C(=O)C(=O)N(Cc3ccc[nH+]c3)C2c2ccc([N+](=O)[O-])cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H25N3O6/c1-20-16-24(11-14-26(20)40-19-21-6-3-2-4-7-21)29(35)27-28(23-9-12-25(13-10-23)34(38)39)33(31(37)30(27)36)18-22-8-5-15-32-17-22/h2-17,28,35H,18-19H2,1H3 |
| InChIKey | XACQNWLBRJEQQC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 126.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|