C30H24N2O4 — CID 6229625
(E)-[4,5-dioxo-2-phenyl-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate (PubChem CID 6229625) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is (E)-[4,5-dioxo-2-phenyl-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate.
| Compound Name | (E)-[4,5-dioxo-2-phenyl-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate |
|---|---|
| PubChem CID | 6229625 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (E)-[4,5-dioxo-2-phenyl-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate |
| SMILES | O=C1C(=O)N(Cc2ccc[nH+]c2)C(c2ccccc2)/C1=C(\[O-])c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2O4/c33-28(24-13-15-25(16-14-24)36-20-21-8-3-1-4-9-21)26-27(23-11-5-2-6-12-23)32(30(35)29(26)34)19-22-10-7-17-31-18-22/h1-18,27,33H,19-20H2/b28-26+ |
| InChIKey | FKBLRXNRXMTXJQ-BYCLXTJYSA-N |
| XLogP | 3.50 |
| TPSA | 83.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|