C31H26N2O5 — CID 6239252
(E)-[2-(2-methoxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate (PubChem CID 6239252) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is (E)-[2-(2-methoxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate.
| Compound Name | (E)-[2-(2-methoxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate |
|---|---|
| PubChem CID | 6239252 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | (E)-[2-(2-methoxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]-(4-phenylmethoxyphenyl)methanolate |
| SMILES | COc1ccccc1C1/C(=C(\[O-])c2ccc(OCc3ccccc3)cc2)C(=O)C(=O)N1Cc1ccc[nH+]c1 |
| InChI | InChI=1S/C31H26N2O5/c1-37-26-12-6-5-11-25(26)28-27(30(35)31(36)33(28)19-22-10-7-17-32-18-22)29(34)23-13-15-24(16-14-23)38-20-21-8-3-2-4-9-21/h2-18,28,34H,19-20H2,1H3/b29-27+ |
| InChIKey | WAXQAMCAOLZWSA-ORIPQNMZSA-N |
| XLogP | 3.51 |
| TPSA | 93.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|