C17H21NO4 — CID 45427653
1-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 45427653) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 45427653 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccccc1/C=C/C(=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C17H21NO4/c1-22-14-8-4-3-7-13(14)9-10-15(19)18-17(16(20)21)11-5-2-6-12-17/h3-4,7-10H,2,5-6,11-12H2,1H3,(H,18,19)(H,20,21)/b10-9+ |
| InChIKey | WGKRPTDSEUWOPW-MDZDMXLPSA-N |
| XLogP | 2.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|