C16H20ClNO4 — CID 22327477
1-[[2-chloro-2-(2-methoxyphenyl)acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 22327477) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is 1-[[2-chloro-2-(2-methoxyphenyl)acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-chloro-2-(2-methoxyphenyl)acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22327477 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[[2-chloro-2-(2-methoxyphenyl)acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccccc1C(Cl)C(=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C16H20ClNO4/c1-22-12-8-4-3-7-11(12)13(17)14(19)18-16(15(20)21)9-5-2-6-10-16/h3-4,7-8,13H,2,5-6,9-10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | ATSJILBUXRLUNU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|