C16H20ClNO4 — CID 22327445
methyl 1-[[2-chloro-2-(4-methoxyphenyl)acetyl]amino]cyclopentane-1-carboxylate (PubChem CID 22327445) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is methyl 1-[[2-chloro-2-(4-methoxyphenyl)acetyl]amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[[2-chloro-2-(4-methoxyphenyl)acetyl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 22327445 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 1-[[2-chloro-2-(4-methoxyphenyl)acetyl]amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)C(Cl)c2ccc(OC)cc2)CCCC1 |
| InChI | InChI=1S/C16H20ClNO4/c1-21-12-7-5-11(6-8-12)13(17)14(19)18-16(15(20)22-2)9-3-4-10-16/h5-8,13H,3-4,9-10H2,1-2H3,(H,18,19) |
| InChIKey | IUFJSANAUYKVTE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|