C21H21ClFNO3 — CID 22904417
1-[[2-chloro-2-(2-fluorophenyl)acetyl]amino]-4-phenylcyclohexane-1-carboxylic acid (PubChem CID 22904417) has the molecular formula C21H21ClFNO3 and a molecular weight of 389.85 g/mol. Its IUPAC name is 1-[[2-chloro-2-(2-fluorophenyl)acetyl]amino]-4-phenylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-chloro-2-(2-fluorophenyl)acetyl]amino]-4-phenylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22904417 |
| Molecular Formula | C21H21ClFNO3 |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-[[2-chloro-2-(2-fluorophenyl)acetyl]amino]-4-phenylcyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCC(c2ccccc2)CC1)C(Cl)c1ccccc1F |
| InChI | InChI=1S/C21H21ClFNO3/c22-18(16-8-4-5-9-17(16)23)19(25)24-21(20(26)27)12-10-15(11-13-21)14-6-2-1-3-7-14/h1-9,15,18H,10-13H2,(H,24,25)(H,26,27) |
| InChIKey | KEKNJBJOAXQEIH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|