C24H23NO4 — CID 45433455
1-(2-naphthalen-1-yloxyacetyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45433455) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-(2-naphthalen-1-yloxyacetyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2-naphthalen-1-yloxyacetyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45433455 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-(2-naphthalen-1-yloxyacetyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(COc1cccc2ccccc12)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23NO4/c26-22(17-29-21-12-6-8-18-7-4-5-11-20(18)21)25-15-13-24(14-16-25,23(27)28)19-9-2-1-3-10-19/h1-12H,13-17H2,(H,27,28) |
| InChIKey | IIBGZILMAWDBJY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |