C32H34ClN5O4 — CID 4545654
N'-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide (PubChem CID 4545654) has the molecular formula C32H34ClN5O4 and a molecular weight of 588.11 g/mol. Its IUPAC name is N'-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide.
| Compound Name | N'-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 4545654 |
| Molecular Formula | C32H34ClN5O4 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | N'-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
| SMILES | COc1ccc2c(c1)c(CC(=O)NNC(=O)CCN1CCN(c3ccccc3)CC1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H34ClN5O4/c1-22-27(28-20-26(42-2)12-13-29(28)38(22)32(41)23-8-10-24(33)11-9-23)21-31(40)35-34-30(39)14-15-36-16-18-37(19-17-36)25-6-4-3-5-7-25/h3-13,20H,14-19,21H2,1-2H3,(H,34,39)(H,35,40) |
| InChIKey | BEOJADMWYLXREX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|