C29H49O9S- — CID 45479359
[(2S,3R,4R,5S)-2-[(1S,2R,4R,5S,7S,11S,12S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-15-yl]-5-ethyl-4-hydroxy-6-methylheptan-3-yl] sulfate (PubChem CID 45479359) has the molecular formula C29H49O9S- and a molecular weight of 573.77 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2-[(1S,2R,4R,5S,7S,11S,12S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-15-yl]-5-ethyl-4-hydroxy-6-methylheptan-3-yl] sulfate.
| Compound Name | [(2S,3R,4R,5S)-2-[(1S,2R,4R,5S,7S,11S,12S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-15-yl]-5-ethyl-4-hydroxy-6-methylheptan-3-yl] sulfate |
|---|---|
| PubChem CID | 45479359 |
| Molecular Formula | C29H49O9S- |
| Molecular Weight | 573.77 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | [(2S,3R,4R,5S)-2-[(1S,2R,4R,5S,7S,11S,12S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-15-yl]-5-ethyl-4-hydroxy-6-methylheptan-3-yl] sulfate |
| SMILES | CC[C@@H](C(C)C)[C@@H](O)[C@H](OS(=O)(=O)[O-])[C@@H](C)[C@H]1CC[C@H]2[C@@H]3COC(=O)[C@H]4C[C@H](O)[C@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H50O9S/c1-7-17(15(2)3)25(32)26(38-39(34,35)36)16(4)19-8-9-20-18-14-37-27(33)22-12-23(30)24(31)13-29(22,6)21(18)10-11-28(19,20)5/h15-26,30-32H,7-14H2,1-6H3,(H,34,35,36)/p-1/t16-,17-,18-,19+,20-,21-,22+,23-,24+,25+,26+,28+,29+/m0/s1 |
| InChIKey | CIZSJGKCVNJXTC-NNPZUXBVSA-M |
| XLogP | 3.26 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|