C24H28ClN3O5 — CID 45480724
2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 4-[(4-nitrobenzoyl)amino]benzoate;hydrochloride (PubChem CID 45480724) has the molecular formula C24H28ClN3O5 and a molecular weight of 473.96 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 4-[(4-nitrobenzoyl)amino]benzoate;hydrochloride.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 4-[(4-nitrobenzoyl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 45480724 |
| Molecular Formula | C24H28ClN3O5 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 4-[(4-nitrobenzoyl)amino]benzoate;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(C(=O)OCC2CCCN3CCCCC23)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H27N3O5.ClH/c28-23(17-8-12-21(13-9-17)27(30)31)25-20-10-6-18(7-11-20)24(29)32-16-19-4-3-15-26-14-2-1-5-22(19)26;/h6-13,19,22H,1-5,14-16H2,(H,25,28);1H |
| InChIKey | BGHZNOWVRIBKFD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|