C22H21FN4O4 — CID 45481699
N'-[7-[(4-fluorophenyl)methylcarbamoyl]-8-hydroxyquinolin-5-yl]-N,N,N'-trimethyloxamide (PubChem CID 45481699) has the molecular formula C22H21FN4O4 and a molecular weight of 424.43 g/mol. Its IUPAC name is N'-[7-[(4-fluorophenyl)methylcarbamoyl]-8-hydroxyquinolin-5-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[7-[(4-fluorophenyl)methylcarbamoyl]-8-hydroxyquinolin-5-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 45481699 |
| Molecular Formula | C22H21FN4O4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N'-[7-[(4-fluorophenyl)methylcarbamoyl]-8-hydroxyquinolin-5-yl]-N,N,N'-trimethyloxamide |
| SMILES | CN(C)C(=O)C(=O)N(C)c1cc(C(=O)NCc2ccc(F)cc2)c(O)c2ncccc12 |
| InChI | InChI=1S/C22H21FN4O4/c1-26(2)21(30)22(31)27(3)17-11-16(19(28)18-15(17)5-4-10-24-18)20(29)25-12-13-6-8-14(23)9-7-13/h4-11,28H,12H2,1-3H3,(H,25,29) |
| InChIKey | WWUWVEGTBIZBFG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|