C16H13FN4OSe — CID 53483026
N-[(4-fluorophenyl)methyl]-1-methyl-4-selanylidenepyrido[3,2-c]pyridazine-3-carboxamide (PubChem CID 53483026) has the molecular formula C16H13FN4OSe and a molecular weight of 375.27 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-methyl-4-selanylidenepyrido[3,2-c]pyridazine-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-methyl-4-selanylidenepyrido[3,2-c]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 53483026 |
| Molecular Formula | C16H13FN4OSe |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-methyl-4-selanylidenepyrido[3,2-c]pyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2ccc(F)cc2)c(=[Se])c2ncccc21 |
| InChI | InChI=1S/C16H13FN4OSe/c1-21-12-3-2-8-18-13(12)15(23)14(20-21)16(22)19-9-10-4-6-11(17)7-5-10/h2-8H,9H2,1H3,(H,19,22) |
| InChIKey | IOTDPSHLVXRRTB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|