C16H13FN4OS — CID 53482181
N-[(4-fluorophenyl)methyl]-1-methyl-4-sulfanylidenepyrido[3,2-c]pyridazine-3-carboxamide (PubChem CID 53482181) has the molecular formula C16H13FN4OS and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-methyl-4-sulfanylidenepyrido[3,2-c]pyridazine-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-methyl-4-sulfanylidenepyrido[3,2-c]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 53482181 |
| Molecular Formula | C16H13FN4OS |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-methyl-4-sulfanylidenepyrido[3,2-c]pyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2ccc(F)cc2)c(=S)c2ncccc21 |
| InChI | InChI=1S/C16H13FN4OS/c1-21-12-3-2-8-18-13(12)15(23)14(20-21)16(22)19-9-10-4-6-11(17)7-5-10/h2-8H,9H2,1H3,(H,19,22) |
| InChIKey | LYVXFUJDDYSUCO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|