C19H24N4O3 — CID 45481900
6-ethyl-5-[(3R)-3-(3,4,5-trimethoxyphenyl)but-1-ynyl]pyrimidine-2,4-diamine (PubChem CID 45481900) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 6-ethyl-5-[(3R)-3-(3,4,5-trimethoxyphenyl)but-1-ynyl]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[(3R)-3-(3,4,5-trimethoxyphenyl)but-1-ynyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 45481900 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 6-ethyl-5-[(3R)-3-(3,4,5-trimethoxyphenyl)but-1-ynyl]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1C#C[C@H](C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-6-14-13(18(20)23-19(21)22-14)8-7-11(2)12-9-15(24-3)17(26-5)16(10-12)25-4/h9-11H,6H2,1-5H3,(H4,20,21,22,23)/t11-/m0/s1 |
| InChIKey | HZBOJNZTLUQBRI-NSHDSACASA-N |
| XLogP | 2.38 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|