About N-hydroxy-2,3-diphenylpropanamide
N-hydroxy-2,3-diphenylpropanamide (PubChem CID 45482658) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is N-hydroxy-2,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-hydroxy-2,3-diphenylpropanamide |
| PubChem CID | 45482658 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-hydroxy-2,3-diphenylpropanamide |
| SMILES | O=C(NO)C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c17-15(16-18)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14,18H,11H2,(H,16,17) |
| InChIKey | SZZUTOJFUFBUFD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2,3-diphenylpropanamide?
The IUPAC name of N-hydroxy-2,3-diphenylpropanamide (CID 45482658) is N-hydroxy-2,3-diphenylpropanamide.
What is the SMILES notation for N-hydroxy-2,3-diphenylpropanamide?
The canonical SMILES for N-hydroxy-2,3-diphenylpropanamide is O=C(NO)C(Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-hydroxy-2,3-diphenylpropanamide?
The InChIKey is SZZUTOJFUFBUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c17-15(16-18)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14,18H,11H2,(H,16,17).
What are the key properties of N-hydroxy-2,3-diphenylpropanamide?
N-hydroxy-2,3-diphenylpropanamide has a molecular weight of 241.29 g/mol, XLogP of 2.52, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2,3-diphenylpropanamide is sourced from PubChem (CID 45482658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).