About 2-phenylacetamide
2-phenylacetamide (PubChem CID 7680) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-phenylacetamide.
Molecular Properties
| Compound Name | 2-phenylacetamide |
| PubChem CID | 7680 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-phenylacetamide |
| SMILES | NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C8H9NO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | LSBDFXRDZJMBSC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylacetamide?
The IUPAC name of 2-phenylacetamide (CID 7680) is 2-phenylacetamide.
What is the SMILES notation for 2-phenylacetamide?
The canonical SMILES for 2-phenylacetamide is NC(=O)Cc1ccccc1.
What is the InChIKey of 2-phenylacetamide?
The InChIKey is LSBDFXRDZJMBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10).
What are the key properties of 2-phenylacetamide?
2-phenylacetamide has a molecular weight of 135.17 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylacetamide is sourced from PubChem (CID 7680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).