About 3-phenylpropanamide
3-phenylpropanamide (PubChem CID 7625) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-phenylpropanamide.
Molecular Properties
| Compound Name | 3-phenylpropanamide |
| PubChem CID | 7625 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-phenylpropanamide |
| SMILES | NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C9H11NO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11) |
| InChIKey | VYIBCOSBNVFEIW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropanamide?
The IUPAC name of 3-phenylpropanamide (CID 7625) is 3-phenylpropanamide.
What is the SMILES notation for 3-phenylpropanamide?
The canonical SMILES for 3-phenylpropanamide is NC(=O)CCc1ccccc1.
What is the InChIKey of 3-phenylpropanamide?
The InChIKey is VYIBCOSBNVFEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11).
What are the key properties of 3-phenylpropanamide?
3-phenylpropanamide has a molecular weight of 149.19 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropanamide is sourced from PubChem (CID 7625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).