C20H25NO5S — CID 45482676
(2R)-3-methyl-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]butanoic acid (PubChem CID 45482676) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is (2R)-3-methyl-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]butanoic acid |
|---|---|
| PubChem CID | 45482676 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2R)-3-methyl-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]butanoic acid |
| SMILES | CC(C)ON([C@@H](C(=O)O)C(C)C)S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-14(2)19(20(22)23)21(26-15(3)4)27(24,25)18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-15,19H,1-4H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | ABXUEPSHNXWTBZ-LJQANCHMSA-N |
| XLogP | 3.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|