C24H25NO5S — CID 150753564
(2R)-2-[benzyl-(4-phenylphenyl)sulfonyloxyamino]-3-methylbutanoic acid (PubChem CID 150753564) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is (2R)-2-[benzyl-(4-phenylphenyl)sulfonyloxyamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[benzyl-(4-phenylphenyl)sulfonyloxyamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 150753564 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (2R)-2-[benzyl-(4-phenylphenyl)sulfonyloxyamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](C(=O)O)N(Cc1ccccc1)OS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-18(2)23(24(26)27)25(17-19-9-5-3-6-10-19)30-31(28,29)22-15-13-21(14-16-22)20-11-7-4-8-12-20/h3-16,18,23H,17H2,1-2H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | JWJMVOXZQJBOBT-HSZRJFAPSA-N |
| XLogP | 4.59 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|