C17H18F2N2O — CID 45483506
1-[2-[(2,3-difluorophenoxy)methyl]phenyl]piperazine (PubChem CID 45483506) has the molecular formula C17H18F2N2O and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-[2-[(2,3-difluorophenoxy)methyl]phenyl]piperazine.
| Compound Name | 1-[2-[(2,3-difluorophenoxy)methyl]phenyl]piperazine |
|---|---|
| PubChem CID | 45483506 |
| Molecular Formula | C17H18F2N2O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[2-[(2,3-difluorophenoxy)methyl]phenyl]piperazine |
| SMILES | Fc1cccc(OCc2ccccc2N2CCNCC2)c1F |
| InChI | InChI=1S/C17H18F2N2O/c18-14-5-3-7-16(17(14)19)22-12-13-4-1-2-6-15(13)21-10-8-20-9-11-21/h1-7,20H,8-12H2 |
| InChIKey | KETAEAPLSWORIE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |