C26H34N6O — CID 45485217
5-[3-(cyclohexylamino)propylamino]-7-(4-ethoxyanilino)-6-methylpyrazolo[1,5-a]pyridine-4-carbonitrile (PubChem CID 45485217) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 5-[3-(cyclohexylamino)propylamino]-7-(4-ethoxyanilino)-6-methylpyrazolo[1,5-a]pyridine-4-carbonitrile.
| Compound Name | 5-[3-(cyclohexylamino)propylamino]-7-(4-ethoxyanilino)-6-methylpyrazolo[1,5-a]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 45485217 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 5-[3-(cyclohexylamino)propylamino]-7-(4-ethoxyanilino)-6-methylpyrazolo[1,5-a]pyridine-4-carbonitrile |
| SMILES | CCOc1ccc(Nc2c(C)c(NCCCNC3CCCCC3)c(C#N)c3ccnn23)cc1 |
| InChI | InChI=1S/C26H34N6O/c1-3-33-22-12-10-21(11-13-22)31-26-19(2)25(23(18-27)24-14-17-30-32(24)26)29-16-7-15-28-20-8-5-4-6-9-20/h10-14,17,20,28-29,31H,3-9,15-16H2,1-2H3 |
| InChIKey | VYMSNEOWGOFYJM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|