C7H11N5 — CID 45485280
4-N-cyclopropylpyrimidine-2,4,6-triamine (PubChem CID 45485280) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-N-cyclopropylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-cyclopropylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 45485280 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-N-cyclopropylpyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(NC2CC2)nc(N)n1 |
| InChI | InChI=1S/C7H11N5/c8-5-3-6(10-4-1-2-4)12-7(9)11-5/h3-4H,1-2H2,(H5,8,9,10,11,12) |
| InChIKey | CKTZEFFCNOTJOP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |