C20H15NO4 — CID 45485316
2-(4,6-dimethoxynaphthalen-2-yl)-1-oxidoindol-1-ium-3-one (PubChem CID 45485316) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-(4,6-dimethoxynaphthalen-2-yl)-1-oxidoindol-1-ium-3-one.
| Compound Name | 2-(4,6-dimethoxynaphthalen-2-yl)-1-oxidoindol-1-ium-3-one |
|---|---|
| PubChem CID | 45485316 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-(4,6-dimethoxynaphthalen-2-yl)-1-oxidoindol-1-ium-3-one |
| SMILES | COc1ccc2cc(C3=[N+]([O-])c4ccccc4C3=O)cc(OC)c2c1 |
| InChI | InChI=1S/C20H15NO4/c1-24-14-8-7-12-9-13(10-18(25-2)16(12)11-14)19-20(22)15-5-3-4-6-17(15)21(19)23/h3-11H,1-2H3 |
| InChIKey | JNSHUCYGOPGUDH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|