C17H13NO4 — CID 25230462
2-(4-acetylphenyl)-5-methoxy-1-oxidoindol-1-ium-3-one (PubChem CID 25230462) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-5-methoxy-1-oxidoindol-1-ium-3-one.
| Compound Name | 2-(4-acetylphenyl)-5-methoxy-1-oxidoindol-1-ium-3-one |
|---|---|
| PubChem CID | 25230462 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(4-acetylphenyl)-5-methoxy-1-oxidoindol-1-ium-3-one |
| SMILES | COc1ccc2c(c1)C(=O)C(c1ccc(C(C)=O)cc1)=[N+]2[O-] |
| InChI | InChI=1S/C17H13NO4/c1-10(19)11-3-5-12(6-4-11)16-17(20)14-9-13(22-2)7-8-15(14)18(16)21/h3-9H,1-2H3 |
| InChIKey | IEPNROOKKAXLSS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|