C34H42O18 — CID 45485875
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-formylphenoxy)-2-(3-oxobutyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 45485875) has the molecular formula C34H42O18 and a molecular weight of 738.69 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-formylphenoxy)-2-(3-oxobutyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-formylphenoxy)-2-(3-oxobutyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45485875 |
| Molecular Formula | C34H42O18 |
| Molecular Weight | 738.69 g/mol |
| Exact Mass | 738.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-formylphenoxy)-2-(3-oxobutyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)CC[C@H]1O[C@@H](Oc2ccc(C=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H42O18/c1-16(36)8-13-25-27(29(45-19(4)39)31(47-21(6)41)33(50-25)49-24-11-9-23(14-35)10-12-24)52-34-32(48-22(7)42)30(46-20(5)40)28(44-18(3)38)26(51-34)15-43-17(2)37/h9-12,14,25-34H,8,13,15H2,1-7H3/t25-,26-,27-,28+,29+,30+,31-,32-,33-,34+/m1/s1 |
| InChIKey | ZHFNJIGNYGKKPZ-RGJOHLCASA-N |
| XLogP | 1.30 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.69 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|