C43H49N9O5 — CID 45487466
4-N,5-N-bis[4-[3-(4-methylpiperazin-1-yl)propanoylamino]phenyl]-9-oxo-10H-acridine-4,5-dicarboxamide (PubChem CID 45487466) has the molecular formula C43H49N9O5 and a molecular weight of 771.92 g/mol. Its IUPAC name is 4-N,5-N-bis[4-[3-(4-methylpiperazin-1-yl)propanoylamino]phenyl]-9-oxo-10H-acridine-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-bis[4-[3-(4-methylpiperazin-1-yl)propanoylamino]phenyl]-9-oxo-10H-acridine-4,5-dicarboxamide |
|---|---|
| PubChem CID | 45487466 |
| Molecular Formula | C43H49N9O5 |
| Molecular Weight | 771.92 g/mol |
| Exact Mass | 771.39 |
| IUPAC Name | 4-N,5-N-bis[4-[3-(4-methylpiperazin-1-yl)propanoylamino]phenyl]-9-oxo-10H-acridine-4,5-dicarboxamide |
| SMILES | CN1CCN(CCC(=O)Nc2ccc(NC(=O)c3cccc4c(=O)c5cccc(C(=O)Nc6ccc(NC(=O)CCN7CCN(C)CC7)cc6)c5[nH]c34)cc2)CC1 |
| InChI | InChI=1S/C43H49N9O5/c1-49-21-25-51(26-22-49)19-17-37(53)44-29-9-13-31(14-10-29)46-42(56)35-7-3-5-33-39(35)48-40-34(41(33)55)6-4-8-36(40)43(57)47-32-15-11-30(12-16-32)45-38(54)18-20-52-27-23-50(2)24-28-52/h3-16H,17-28H2,1-2H3,(H,44,53)(H,45,54)(H,46,56)(H,47,57)(H,48,55) |
| InChIKey | HVJXATOMEARPOZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.92 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|