C31H42N6O3 — CID 45488784
N-benzyl-4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrimidine-5-carboxamide (PubChem CID 45488784) has the molecular formula C31H42N6O3 and a molecular weight of 546.72 g/mol. Its IUPAC name is N-benzyl-4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrimidine-5-carboxamide.
| Compound Name | N-benzyl-4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 45488784 |
| Molecular Formula | C31H42N6O3 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | N-benzyl-4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(CCNc2nc(NCCCN3CCCCC3C)ncc2C(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C31H42N6O3/c1-23-10-7-8-18-37(23)19-9-16-33-31-35-22-26(30(38)34-21-25-11-5-4-6-12-25)29(36-31)32-17-15-24-13-14-27(39-2)28(20-24)40-3/h4-6,11-14,20,22-23H,7-10,15-19,21H2,1-3H3,(H,34,38)(H2,32,33,35,36) |
| InChIKey | FSSBVFWLBVKLER-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|