C25H35N7O3 — CID 45489154
4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(3-imidazol-1-ylpropylamino)-N-(2-methylpropyl)pyrimidine-5-carboxamide (PubChem CID 45489154) has the molecular formula C25H35N7O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(3-imidazol-1-ylpropylamino)-N-(2-methylpropyl)pyrimidine-5-carboxamide.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(3-imidazol-1-ylpropylamino)-N-(2-methylpropyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 45489154 |
| Molecular Formula | C25H35N7O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(3-imidazol-1-ylpropylamino)-N-(2-methylpropyl)pyrimidine-5-carboxamide |
| SMILES | COc1ccc(CCNc2nc(NCCCn3ccnc3)ncc2C(=O)NCC(C)C)cc1OC |
| InChI | InChI=1S/C25H35N7O3/c1-18(2)15-29-24(33)20-16-30-25(28-9-5-12-32-13-11-26-17-32)31-23(20)27-10-8-19-6-7-21(34-3)22(14-19)35-4/h6-7,11,13-14,16-18H,5,8-10,12,15H2,1-4H3,(H,29,33)(H2,27,28,30,31) |
| InChIKey | IKLAPAHQBDXLPX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|