C15H18N4O4 — CID 45491121
3-[2-(benzylamino)-2-oxoethyl]-N-(3-hydroxypropyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 45491121) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-[2-(benzylamino)-2-oxoethyl]-N-(3-hydroxypropyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[2-(benzylamino)-2-oxoethyl]-N-(3-hydroxypropyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 45491121 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 3-[2-(benzylamino)-2-oxoethyl]-N-(3-hydroxypropyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(Cc1noc(C(=O)NCCCO)n1)NCc1ccccc1 |
| InChI | InChI=1S/C15H18N4O4/c20-8-4-7-16-14(22)15-18-12(19-23-15)9-13(21)17-10-11-5-2-1-3-6-11/h1-3,5-6,20H,4,7-10H2,(H,16,22)(H,17,21) |
| InChIKey | SYTIHQRDHICXAQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|