C23H25N3O5 — CID 45494783
6,7-dimethoxy-3-[3-oxo-3-(2-phenylmorpholin-4-yl)propyl]quinazolin-4-one (PubChem CID 45494783) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 6,7-dimethoxy-3-[3-oxo-3-(2-phenylmorpholin-4-yl)propyl]quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-3-[3-oxo-3-(2-phenylmorpholin-4-yl)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 45494783 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 6,7-dimethoxy-3-[3-oxo-3-(2-phenylmorpholin-4-yl)propyl]quinazolin-4-one |
| SMILES | COc1cc2ncn(CCC(=O)N3CCOC(c4ccccc4)C3)c(=O)c2cc1OC |
| InChI | InChI=1S/C23H25N3O5/c1-29-19-12-17-18(13-20(19)30-2)24-15-26(23(17)28)9-8-22(27)25-10-11-31-21(14-25)16-6-4-3-5-7-16/h3-7,12-13,15,21H,8-11,14H2,1-2H3 |
| InChIKey | DPVYWFAFXIJDNM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |