C22H24N2O2 — CID 52900417
3-(4-methylindol-1-yl)-1-[(2S)-2-phenylmorpholin-4-yl]propan-1-one (PubChem CID 52900417) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-(4-methylindol-1-yl)-1-[(2S)-2-phenylmorpholin-4-yl]propan-1-one.
| Compound Name | 3-(4-methylindol-1-yl)-1-[(2S)-2-phenylmorpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 52900417 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 3-(4-methylindol-1-yl)-1-[(2S)-2-phenylmorpholin-4-yl]propan-1-one |
| SMILES | Cc1cccc2c1ccn2CCC(=O)N1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H24N2O2/c1-17-6-5-9-20-19(17)10-12-23(20)13-11-22(25)24-14-15-26-21(16-24)18-7-3-2-4-8-18/h2-10,12,21H,11,13-16H2,1H3/t21-/m1/s1 |
| InChIKey | WIFYFONXSBAFNC-OAQYLSRUSA-N |
| XLogP | 3.94 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |