About N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide
N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide (PubChem CID 45497336) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide |
| PubChem CID | 45497336 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide |
| SMILES | COCC(C)NC(=O)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C13H24N2O3/c1-10(9-18-2)14-12(16)13(17)15-11-7-5-3-4-6-8-11/h10-11H,3-9H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | FTWUFDRYEZHJDE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide?
The IUPAC name of N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide (CID 45497336) is N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide.
What is the SMILES notation for N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide?
The canonical SMILES for N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide is COCC(C)NC(=O)C(=O)NC1CCCCCC1.
What is the InChIKey of N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide?
The InChIKey is FTWUFDRYEZHJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-10(9-18-2)14-12(16)13(17)15-11-7-5-3-4-6-8-11/h10-11H,3-9H2,1-2H3,(H,14,16)(H,15,17).
What are the key properties of N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide?
N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide has a molecular weight of 256.35 g/mol, XLogP of 0.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-N'-(1-methoxypropan-2-yl)oxamide is sourced from PubChem (CID 45497336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).