C21H18N4OS — CID 4550693
2-amino-4-cyclohex-3-en-1-yl-6-phenacylsulfanylpyridine-3,5-dicarbonitrile (PubChem CID 4550693) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-amino-4-cyclohex-3-en-1-yl-6-phenacylsulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-cyclohex-3-en-1-yl-6-phenacylsulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 4550693 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-amino-4-cyclohex-3-en-1-yl-6-phenacylsulfanylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SCC(=O)c2ccccc2)c(C#N)c1C1CC=CCC1 |
| InChI | InChI=1S/C21H18N4OS/c22-11-16-19(15-9-5-2-6-10-15)17(12-23)21(25-20(16)24)27-13-18(26)14-7-3-1-4-8-14/h1-5,7-8,15H,6,9-10,13H2,(H2,24,25) |
| InChIKey | VTCGRQIFLANXHW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|