C11H14N4O3S — CID 4551327
[6-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl] 2-ethoxyacetate (PubChem CID 4551327) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is [6-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl] 2-ethoxyacetate.
| Compound Name | [6-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 4551327 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | [6-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)Oc1ccc(C=NNC(N)=S)nc1 |
| InChI | InChI=1S/C11H14N4O3S/c1-2-17-7-10(16)18-9-4-3-8(13-6-9)5-14-15-11(12)19/h3-6H,2,7H2,1H3,(H3,12,15,19) |
| InChIKey | JIGAKJNGMYEKJA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|