C15H17N3O4 — CID 4552497
N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-(4-propan-2-ylphenoxy)acetamide (PubChem CID 4552497) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-(4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 4552497 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-2-(4-propan-2-ylphenoxy)acetamide |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H17N3O4/c1-9(2)10-3-5-11(6-4-10)22-8-13(19)17-12-7-16-15(21)18-14(12)20/h3-7,9H,8H2,1-2H3,(H,17,19)(H2,16,18,20,21) |
| InChIKey | QBOUNIUCMVESIK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |