C23H19N3O — CID 4554842
8-methyl-N',2-diphenylquinoline-4-carbohydrazide (PubChem CID 4554842) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is 8-methyl-N',2-diphenylquinoline-4-carbohydrazide.
| Compound Name | 8-methyl-N',2-diphenylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 4554842 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 8-methyl-N',2-diphenylquinoline-4-carbohydrazide |
| SMILES | Cc1cccc2c(C(=O)NNc3ccccc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C23H19N3O/c1-16-9-8-14-19-20(23(27)26-25-18-12-6-3-7-13-18)15-21(24-22(16)19)17-10-4-2-5-11-17/h2-15,25H,1H3,(H,26,27) |
| InChIKey | TWUIUEBRNHJJII-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|