C27H28N3O2+ — CID 4558733
3-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-1H-indole-7-carboxylate (PubChem CID 4558733) has the molecular formula C27H28N3O2+ and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-1H-indole-7-carboxylate.
| Compound Name | 3-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 4558733 |
| Molecular Formula | C27H28N3O2+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 3-[(4-benzhydrylpiperazine-1,4-diium-1-yl)methyl]-1H-indole-7-carboxylate |
| SMILES | O=C([O-])c1cccc2c(C[NH+]3CC[NH+](C(c4ccccc4)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C27H27N3O2/c31-27(32)24-13-7-12-23-22(18-28-25(23)24)19-29-14-16-30(17-15-29)26(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,26,28H,14-17,19H2,(H,31,32)/p+1 |
| InChIKey | RLEQWCPSRFQKGF-UHFFFAOYSA-O |
| XLogP | 0.60 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |